ワンクリックで
molclaw-boltz2-affinity
// Predict binding affinity between target protein sequence and small molecule SMILES using Boltz-2.
// Predict binding affinity between target protein sequence and small molecule SMILES using Boltz-2.
Predict the ADMET (absorption, distribution, metabolism, excretion, and toxicity) properties of the input molecules.
Predict protein structures with Chai-1 from sequence or FASTA input and return model scoring summaries.
Chroma toolkit skill covering chroma_monomer for single-chain generation, chroma_complex for multi-chain assembly generation, and chroma_symmetry for symmetry-constrained protein design.
Retrieve SMILES strings from PubChem database using compound names.
Generate new molecules de novo.
[CURRENTLY UNAVAILABLE] DiffDock protein-ligand docking. This tool is not deployed on the current MCP server. Use molclaw-quickvina-docking or molclaw-karmadock-tool as alternatives.
| name | molclaw-boltz2-affinity |
| description | Predict binding affinity between target protein sequence and small molecule SMILES using Boltz-2. |
| license | MIT license |
| metadata | {"skill-author":"PJLab"} |
Note:
molclaw-file-transfer before execution.molclaw-pdbfixer before execution.molclaw-scp-server to complete tool invocation.step 1. Use skill molclaw-protein-sequence-retrieve to get the target protein sequence information. If the target protein sequence has been provided, skip this step.
step 2. Finally use tool pred_binding_affinity_boltz2 to predict the binding affinity.
Tool description:
Use Boltz to predict binding affinity between protein (receptor) and small molecule (ligand).
Args:
protein (List[dict]): Protein chains, each element contains 'chain' and 'sequence' (e.g., [{{'chain': 'A', 'sequence': 'MGNAAAAKKGSEQASQRRSSLEQP*'}}])
smiles (str): Input SMILES string (e.g., "N[C@@H](Cc1ccc(O)cc1)C(=O)O")
Return:
status (str): success/error
msg (str): message
affinity_probability_binary (float): Represents the predicted probability (ranging from 0 to 1) that a ligand is a binder, making it ideal for distinguishing active compounds from decoys during the hit-discovery stage. A value below 0.5 indicates uncertain or weak binding.
affinity_pred_value (float): Estimates the specific binding affinity as log10(IC50) in μM to quantify how small molecular modifications affect potency, serving as a key metric for ligand optimization phases like hit-to-lead and lead-optimization.
complex_cif_file (str): Structure file of the protein–molecule complex
Tool usage:
response = await client.session.call_tool(
"pred_binding_affinity_boltz2",
arguments={
"protein": protein_chains,
"smiles": smiles
}
)
result = client.parse_result(response)
affinity_probability_binary = result["affinity_probability_binary"]
affinity_pred_value = result["affinity_pred_value"]