molclaw-dleps

name	molclaw-dleps
description	Calculate disease reversal scores for the provided molecules relative to a specific disease.
license	MIT license
metadata	{"skill-author":"PJLab"}

DLEPS Score Calculation

The description of tool calculate_dleps_score.

Enter a list of candidate small molecules. Based on the input disease name, identify upregulated and downregulated genes associated with the disease state, and predict a reversal score for each small molecule. Generally, a score above 0.2 indicates effectiveness, with higher scores being better.
Args:
    smiles_list (List[str]): List of input SMILES strings, (e.g., ["N[C@@H](Cc1ccc(O)cc1)C(=O)O", "CC(C)C1=CC=CC=C1"])
    disease_name (str): Supportes diseases, e.g., "Aging", "Gout", "Pulmonary fibrosis", "Non-alcoholic fatty liver disease", "Obesity" 
Return:
    status (str): success/error
    msg (str): message
    pred_scores (List[dict]): List of dict, each containing the keys 'smiles' and 'cs_score'. 
        --smiles (str): A SMILES string of smiles_list 
        --cs_score (float): Predicted reverse score

How to use tool calculate_dleps_score :

response = await client.session.call_tool(
    "calculate_dleps_score",
    arguments={
        "smiles_list": smiles_list,
        "disease_name": disease_name
    }
)
result = client.parse_result(response)
pred_scores = result["pred_scores"]